C27H31NO6 — CID 122680506
(4aR,11aR,12aS)-3-(1-aminoethenyl)-4,4a,6,7-tetrahydroxy-10-[(E)-2-methylhex-1-enyl]-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione (PubChem CID 122680506) has the molecular formula C27H31NO6 and a molecular weight of 465.55 g/mol. Its IUPAC name is (4aR,11aR,12aS)-3-(1-aminoethenyl)-4,4a,6,7-tetrahydroxy-10-[(E)-2-methylhex-1-enyl]-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione.
| Compound Name | (4aR,11aR,12aS)-3-(1-aminoethenyl)-4,4a,6,7-tetrahydroxy-10-[(E)-2-methylhex-1-enyl]-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
|---|---|
| PubChem CID | 122680506 |
| Molecular Formula | C27H31NO6 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | (4aR,11aR,12aS)-3-(1-aminoethenyl)-4,4a,6,7-tetrahydroxy-10-[(E)-2-methylhex-1-enyl]-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
| SMILES | C=C(N)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(/C=C(\C)CCCC)c4C[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C27H31NO6/c1-4-5-6-13(2)9-15-7-8-19(29)23-18(15)11-16-10-17-12-20(30)21(14(3)28)25(32)27(17,34)26(33)22(16)24(23)31/h7-9,16-17,29,31-32,34H,3-6,10-12,28H2,1-2H3/b13-9+/t16-,17+,27-/m1/s1 |
| InChIKey | LYTZJQUDRNPJMK-RVYGKMHFSA-N |
| XLogP | 4.00 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |