C20H37N3O7 — CID 122682447
6-methoxy-5-methyl-2-[[4-[2-[2-(3-methylbutoxy)ethoxy]ethoxymethyl]triazol-1-yl]methyl]oxane-3,4-diol (PubChem CID 122682447) has the molecular formula C20H37N3O7 and a molecular weight of 431.53 g/mol. Its IUPAC name is 6-methoxy-5-methyl-2-[[4-[2-[2-(3-methylbutoxy)ethoxy]ethoxymethyl]triazol-1-yl]methyl]oxane-3,4-diol.
| Compound Name | 6-methoxy-5-methyl-2-[[4-[2-[2-(3-methylbutoxy)ethoxy]ethoxymethyl]triazol-1-yl]methyl]oxane-3,4-diol |
|---|---|
| PubChem CID | 122682447 |
| Molecular Formula | C20H37N3O7 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | 6-methoxy-5-methyl-2-[[4-[2-[2-(3-methylbutoxy)ethoxy]ethoxymethyl]triazol-1-yl]methyl]oxane-3,4-diol |
| SMILES | COC1OC(Cn2cc(COCCOCCOCCC(C)C)nn2)C(O)C(O)C1C |
| InChI | InChI=1S/C20H37N3O7/c1-14(2)5-6-27-7-8-28-9-10-29-13-16-11-23(22-21-16)12-17-19(25)18(24)15(3)20(26-4)30-17/h11,14-15,17-20,24-25H,5-10,12-13H2,1-4H3 |
| InChIKey | YFLUYBYUCFUQHA-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 117.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|