C38H70N6O12 — CID 155644069
(3S,4S,6R)-2-(azidomethyl)-6-[(2R,5S)-6-[[4-(1,3-didecoxypropan-2-yloxymethyl)triazol-1-yl]methyl]-3,4,5-trihydroxyoxan-2-yl]oxyoxane-3,4,5-triol (PubChem CID 155644069) has the molecular formula C38H70N6O12 and a molecular weight of 803.01 g/mol. Its IUPAC name is (3S,4S,6R)-2-(azidomethyl)-6-[(2R,5S)-6-[[4-(1,3-didecoxypropan-2-yloxymethyl)triazol-1-yl]methyl]-3,4,5-trihydroxyoxan-2-yl]oxyoxane-3,4,5-triol.
| Compound Name | (3S,4S,6R)-2-(azidomethyl)-6-[(2R,5S)-6-[[4-(1,3-didecoxypropan-2-yloxymethyl)triazol-1-yl]methyl]-3,4,5-trihydroxyoxan-2-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 155644069 |
| Molecular Formula | C38H70N6O12 |
| Molecular Weight | 803.01 g/mol |
| Exact Mass | 802.51 |
| IUPAC Name | (3S,4S,6R)-2-(azidomethyl)-6-[(2R,5S)-6-[[4-(1,3-didecoxypropan-2-yloxymethyl)triazol-1-yl]methyl]-3,4,5-trihydroxyoxan-2-yl]oxyoxane-3,4,5-triol |
| SMILES | CCCCCCCCCCOCC(COCCCCCCCCCC)OCc1cn(CC2O[C@H](O[C@H]3OC(CN=[N+]=[N-])[C@@H](O)[C@H](O)C3O)C(O)C(O)[C@@H]2O)nn1 |
| InChI | InChI=1S/C38H70N6O12/c1-3-5-7-9-11-13-15-17-19-51-25-28(26-52-20-18-16-14-12-10-8-6-4-2)53-24-27-22-44(43-41-27)23-30-32(46)34(48)36(50)38(55-30)56-37-35(49)33(47)31(45)29(54-37)21-40-42-39/h22,28-38,45-50H,3-21,23-26H2,1-2H3/t29?,30?,31-,32-,33+,34?,35?,36?,37-,38-/m1/s1 |
| InChIKey | VFJXVZVHHWBITJ-JZJGRXOLSA-N |
| XLogP | 3.42 |
| TPSA | 256.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.01 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|