C28H50N6O12 — CID 155644041
(3S,4S,6R)-2-(azidomethyl)-6-[(2R,5S)-6-[[4-(1,3-dipentoxypropan-2-yloxymethyl)triazol-1-yl]methyl]-3,4,5-trihydroxyoxan-2-yl]oxyoxane-3,4,5-triol (PubChem CID 155644041) has the molecular formula C28H50N6O12 and a molecular weight of 662.74 g/mol. Its IUPAC name is (3S,4S,6R)-2-(azidomethyl)-6-[(2R,5S)-6-[[4-(1,3-dipentoxypropan-2-yloxymethyl)triazol-1-yl]methyl]-3,4,5-trihydroxyoxan-2-yl]oxyoxane-3,4,5-triol.
| Compound Name | (3S,4S,6R)-2-(azidomethyl)-6-[(2R,5S)-6-[[4-(1,3-dipentoxypropan-2-yloxymethyl)triazol-1-yl]methyl]-3,4,5-trihydroxyoxan-2-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 155644041 |
| Molecular Formula | C28H50N6O12 |
| Molecular Weight | 662.74 g/mol |
| Exact Mass | 662.35 |
| IUPAC Name | (3S,4S,6R)-2-(azidomethyl)-6-[(2R,5S)-6-[[4-(1,3-dipentoxypropan-2-yloxymethyl)triazol-1-yl]methyl]-3,4,5-trihydroxyoxan-2-yl]oxyoxane-3,4,5-triol |
| SMILES | CCCCCOCC(COCCCCC)OCc1cn(CC2O[C@H](O[C@H]3OC(CN=[N+]=[N-])[C@@H](O)[C@H](O)C3O)C(O)C(O)[C@@H]2O)nn1 |
| InChI | InChI=1S/C28H50N6O12/c1-3-5-7-9-41-15-18(16-42-10-8-6-4-2)43-14-17-12-34(33-31-17)13-20-22(36)24(38)26(40)28(45-20)46-27-25(39)23(37)21(35)19(44-27)11-30-32-29/h12,18-28,35-40H,3-11,13-16H2,1-2H3/t19?,20?,21-,22-,23+,24?,25?,26?,27-,28-/m1/s1 |
| InChIKey | OYTFNGRGLJHMLW-RLAMHIROSA-N |
| XLogP | -0.48 |
| TPSA | 256.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.74 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|