C21H17BrClFN4O — CID 122686374
5-bromo-11-chloro-8-[(3-fluoro-2-pyridinyl)-(oxan-4-yl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 122686374) has the molecular formula C21H17BrClFN4O and a molecular weight of 475.75 g/mol. Its IUPAC name is 5-bromo-11-chloro-8-[(3-fluoro-2-pyridinyl)-(oxan-4-yl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 5-bromo-11-chloro-8-[(3-fluoro-2-pyridinyl)-(oxan-4-yl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 122686374 |
| Molecular Formula | C21H17BrClFN4O |
| Molecular Weight | 475.75 g/mol |
| Exact Mass | 474.03 |
| IUPAC Name | 5-bromo-11-chloro-8-[(3-fluoro-2-pyridinyl)-(oxan-4-yl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Fc1cccnc1C(C1CCOCC1)n1c2cc(Br)cnc2c2ccc(Cl)nc21 |
| InChI | InChI=1S/C21H17BrClFN4O/c22-13-10-16-18(26-11-13)14-3-4-17(23)27-21(14)28(16)20(12-5-8-29-9-6-12)19-15(24)2-1-7-25-19/h1-4,7,10-12,20H,5-6,8-9H2 |
| InChIKey | HTGNYOQXOFTXQK-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.75 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|