C26H22BrFN2O2 — CID 155702258
13-bromo-7-fluoro-16-[oxan-4-yl(phenyl)methyl]-11,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1,6,8,10(15),11,13-hexaen-5-one (PubChem CID 155702258) has the molecular formula C26H22BrFN2O2 and a molecular weight of 493.38 g/mol. Its IUPAC name is 13-bromo-7-fluoro-16-[oxan-4-yl(phenyl)methyl]-11,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1,6,8,10(15),11,13-hexaen-5-one.
| Compound Name | 13-bromo-7-fluoro-16-[oxan-4-yl(phenyl)methyl]-11,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1,6,8,10(15),11,13-hexaen-5-one |
|---|---|
| PubChem CID | 155702258 |
| Molecular Formula | C26H22BrFN2O2 |
| Molecular Weight | 493.38 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | 13-bromo-7-fluoro-16-[oxan-4-yl(phenyl)methyl]-11,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1,6,8,10(15),11,13-hexaen-5-one |
| SMILES | O=C1CCc2c1c(F)cc1c3ncc(Br)cc3n(C(c3ccccc3)C3CCOCC3)c21 |
| InChI | InChI=1S/C26H22BrFN2O2/c27-17-12-21-24(29-14-17)19-13-20(28)23-18(6-7-22(23)31)26(19)30(21)25(15-4-2-1-3-5-15)16-8-10-32-11-9-16/h1-5,12-14,16,25H,6-11H2 |
| InChIKey | GIPMJLQPSBJJOS-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.38 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |