C30H33BN2O5 — CID 154501999
5-[oxan-4-yl(phenyl)methyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[3,2-b]indole-7-carboxylic acid (PubChem CID 154501999) has the molecular formula C30H33BN2O5 and a molecular weight of 512.42 g/mol. Its IUPAC name is 5-[oxan-4-yl(phenyl)methyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[3,2-b]indole-7-carboxylic acid.
| Compound Name | 5-[oxan-4-yl(phenyl)methyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[3,2-b]indole-7-carboxylic acid |
|---|---|
| PubChem CID | 154501999 |
| Molecular Formula | C30H33BN2O5 |
| Molecular Weight | 512.42 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | 5-[oxan-4-yl(phenyl)methyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[3,2-b]indole-7-carboxylic acid |
| SMILES | CC1(C)OB(c2cnc3c4ccc(C(=O)O)cc4n(C(c4ccccc4)C4CCOCC4)c3c2)OC1(C)C |
| InChI | InChI=1S/C30H33BN2O5/c1-29(2)30(3,4)38-31(37-29)22-17-25-26(32-18-22)23-11-10-21(28(34)35)16-24(23)33(25)27(19-8-6-5-7-9-19)20-12-14-36-15-13-20/h5-11,16-18,20,27H,12-15H2,1-4H3,(H,34,35) |
| InChIKey | ZQZGMJXMWORZSL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.42 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|