C29H34BrN5O2 — CID 144877554
2-[3-[(E)-2-amino-1-[amino(methyl)amino]-2-bromoethenyl]-5-[(S)-oxan-4-yl(phenyl)methyl]pyrido[3,2-b]indol-7-yl]propan-2-ol (PubChem CID 144877554) has the molecular formula C29H34BrN5O2 and a molecular weight of 564.53 g/mol. Its IUPAC name is 2-[3-[(E)-2-amino-1-[amino(methyl)amino]-2-bromoethenyl]-5-[(S)-oxan-4-yl(phenyl)methyl]pyrido[3,2-b]indol-7-yl]propan-2-ol.
| Compound Name | 2-[3-[(E)-2-amino-1-[amino(methyl)amino]-2-bromoethenyl]-5-[(S)-oxan-4-yl(phenyl)methyl]pyrido[3,2-b]indol-7-yl]propan-2-ol |
|---|---|
| PubChem CID | 144877554 |
| Molecular Formula | C29H34BrN5O2 |
| Molecular Weight | 564.53 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | 2-[3-[(E)-2-amino-1-[amino(methyl)amino]-2-bromoethenyl]-5-[(S)-oxan-4-yl(phenyl)methyl]pyrido[3,2-b]indol-7-yl]propan-2-ol |
| SMILES | CN(N)/C(=C(\N)Br)c1cnc2c3ccc(C(C)(C)O)cc3n(C(c3ccccc3)C3CCOCC3)c2c1 |
| InChI | InChI=1S/C29H34BrN5O2/c1-29(2,36)21-9-10-22-23(16-21)35(24-15-20(17-33-25(22)24)27(28(30)31)34(3)32)26(18-7-5-4-6-8-18)19-11-13-37-14-12-19/h4-10,15-17,19,26,36H,11-14,31-32H2,1-3H3/b28-27- |
| InChIKey | UNYJVSUJQZIMQG-DQSJHHFOSA-N |
| XLogP | 5.22 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|