C31H40N8O — CID 139354695
(Z)-1-[amino(methyl)amino]-1-[10-(4-methylpiperazin-1-yl)-8-[oxan-4-yl(phenyl)methyl]-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine (PubChem CID 139354695) has the molecular formula C31H40N8O and a molecular weight of 540.72 g/mol. Its IUPAC name is (Z)-1-[amino(methyl)amino]-1-[10-(4-methylpiperazin-1-yl)-8-[oxan-4-yl(phenyl)methyl]-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine.
| Compound Name | (Z)-1-[amino(methyl)amino]-1-[10-(4-methylpiperazin-1-yl)-8-[oxan-4-yl(phenyl)methyl]-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine |
|---|---|
| PubChem CID | 139354695 |
| Molecular Formula | C31H40N8O |
| Molecular Weight | 540.72 g/mol |
| Exact Mass | 540.33 |
| IUPAC Name | (Z)-1-[amino(methyl)amino]-1-[10-(4-methylpiperazin-1-yl)-8-[oxan-4-yl(phenyl)methyl]-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine |
| SMILES | C/C(N)=C(\c1cnc2c3ccnc(N4CCN(C)CC4)c3n(C(c3ccccc3)C3CCOCC3)c2c1)N(C)N |
| InChI | InChI=1S/C31H40N8O/c1-21(32)28(37(3)33)24-19-26-27(35-20-24)25-9-12-34-31(38-15-13-36(2)14-16-38)30(25)39(26)29(22-7-5-4-6-8-22)23-10-17-40-18-11-23/h4-9,12,19-20,23,29H,10-11,13-18,32-33H2,1-3H3/b28-21- |
| InChIKey | YUSUOUCKZKMTLT-HFTWOUSFSA-N |
| XLogP | 3.81 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.72 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|