C30H39N7O2 — CID 145187623
(Z)-1-[amino(methyl)amino]-1-[11-morpholin-4-yl-8-(oxan-4-ylmethyl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine;benzene (PubChem CID 145187623) has the molecular formula C30H39N7O2 and a molecular weight of 529.69 g/mol. Its IUPAC name is (Z)-1-[amino(methyl)amino]-1-[11-morpholin-4-yl-8-(oxan-4-ylmethyl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine;benzene.
| Compound Name | (Z)-1-[amino(methyl)amino]-1-[11-morpholin-4-yl-8-(oxan-4-ylmethyl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine;benzene |
|---|---|
| PubChem CID | 145187623 |
| Molecular Formula | C30H39N7O2 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.32 |
| IUPAC Name | (Z)-1-[amino(methyl)amino]-1-[11-morpholin-4-yl-8-(oxan-4-ylmethyl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine;benzene |
| SMILES | C/C(N)=C(\c1cnc2c3ccc(N4CCOCC4)nc3n(CC3CCOCC3)c2c1)N(C)N.c1ccccc1 |
| InChI | InChI=1S/C24H33N7O2.C6H6/c1-16(25)23(29(2)26)18-13-20-22(27-14-18)19-3-4-21(30-7-11-33-12-8-30)28-24(19)31(20)15-17-5-9-32-10-6-17;1-2-4-6-5-3-1/h3-4,13-14,17H,5-12,15,25-26H2,1-2H3;1-6H/b23-16-; |
| InChIKey | XEJFEBLALILPGQ-YGCQTIHHSA-N |
| XLogP | 3.99 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|