C26H37N7OS — CID 145187572
(Z)-1-[amino(methyl)amino]-1-[11-(2,6-dimethylthiomorpholin-4-yl)-8-(oxan-4-ylmethyl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine (PubChem CID 145187572) has the molecular formula C26H37N7OS and a molecular weight of 495.70 g/mol. Its IUPAC name is (Z)-1-[amino(methyl)amino]-1-[11-(2,6-dimethylthiomorpholin-4-yl)-8-(oxan-4-ylmethyl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine.
| Compound Name | (Z)-1-[amino(methyl)amino]-1-[11-(2,6-dimethylthiomorpholin-4-yl)-8-(oxan-4-ylmethyl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine |
|---|---|
| PubChem CID | 145187572 |
| Molecular Formula | C26H37N7OS |
| Molecular Weight | 495.70 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | (Z)-1-[amino(methyl)amino]-1-[11-(2,6-dimethylthiomorpholin-4-yl)-8-(oxan-4-ylmethyl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine |
| SMILES | C/C(N)=C(\c1cnc2c3ccc(N4CC(C)SC(C)C4)nc3n(CC3CCOCC3)c2c1)N(C)N |
| InChI | InChI=1S/C26H37N7OS/c1-16-13-32(14-17(2)35-16)23-6-5-21-24-22(11-20(12-29-24)25(18(3)27)31(4)28)33(26(21)30-23)15-19-7-9-34-10-8-19/h5-6,11-12,16-17,19H,7-10,13-15,27-28H2,1-4H3/b25-18- |
| InChIKey | VYDMFIGEXUJUGT-BWAHOGKJSA-N |
| XLogP | 3.79 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.70 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|