C20H25ClN6O — CID 139354736
(Z)-1-[amino(methyl)amino]-1-[10-chloro-8-(oxan-4-ylmethyl)-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-5-yl]prop-1-en-2-amine (PubChem CID 139354736) has the molecular formula C20H25ClN6O and a molecular weight of 400.91 g/mol. Its IUPAC name is (Z)-1-[amino(methyl)amino]-1-[10-chloro-8-(oxan-4-ylmethyl)-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-5-yl]prop-1-en-2-amine.
| Compound Name | (Z)-1-[amino(methyl)amino]-1-[10-chloro-8-(oxan-4-ylmethyl)-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-5-yl]prop-1-en-2-amine |
|---|---|
| PubChem CID | 139354736 |
| Molecular Formula | C20H25ClN6O |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | (Z)-1-[amino(methyl)amino]-1-[10-chloro-8-(oxan-4-ylmethyl)-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-5-yl]prop-1-en-2-amine |
| SMILES | C/C(N)=C(\c1cnc2c3cncc(Cl)c3n(CC3CCOCC3)c2c1)N(C)N |
| InChI | InChI=1S/C20H25ClN6O/c1-12(22)19(26(2)23)14-7-17-18(25-8-14)15-9-24-10-16(21)20(15)27(17)11-13-3-5-28-6-4-13/h7-10,13H,3-6,11,22-23H2,1-2H3/b19-12- |
| InChIKey | FYDXRCLXSQBWGB-UNOMPAQXSA-N |
| XLogP | 3.12 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|