C25H35N7O2 — CID 139354713
N-[5-[(Z)-2-amino-1-[amino(methyl)amino]prop-1-enyl]-8-(oxan-4-ylmethyl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]-2,2-dimethylpropanamide (PubChem CID 139354713) has the molecular formula C25H35N7O2 and a molecular weight of 465.60 g/mol. Its IUPAC name is N-[5-[(Z)-2-amino-1-[amino(methyl)amino]prop-1-enyl]-8-(oxan-4-ylmethyl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[5-[(Z)-2-amino-1-[amino(methyl)amino]prop-1-enyl]-8-(oxan-4-ylmethyl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 139354713 |
| Molecular Formula | C25H35N7O2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.29 |
| IUPAC Name | N-[5-[(Z)-2-amino-1-[amino(methyl)amino]prop-1-enyl]-8-(oxan-4-ylmethyl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]-2,2-dimethylpropanamide |
| SMILES | C/C(N)=C(\c1cnc2c3ccc(NC(=O)C(C)(C)C)nc3n(CC3CCOCC3)c2c1)N(C)N |
| InChI | InChI=1S/C25H35N7O2/c1-15(26)22(31(5)27)17-12-19-21(28-13-17)18-6-7-20(30-24(33)25(2,3)4)29-23(18)32(19)14-16-8-10-34-11-9-16/h6-7,12-13,16H,8-11,14,26-27H2,1-5H3,(H,29,30,33)/b22-15- |
| InChIKey | ORRDLWQBVXGAQI-JCMHNJIXSA-N |
| XLogP | 3.45 |
| TPSA | 124.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|