C22H28N4O2 — CID 138527836
[3-[(Z)-2-amino-1-(methylamino)prop-1-enyl]-5-(oxan-4-ylmethyl)pyrido[3,2-b]indol-7-yl]methanol (PubChem CID 138527836) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is [3-[(Z)-2-amino-1-(methylamino)prop-1-enyl]-5-(oxan-4-ylmethyl)pyrido[3,2-b]indol-7-yl]methanol.
| Compound Name | [3-[(Z)-2-amino-1-(methylamino)prop-1-enyl]-5-(oxan-4-ylmethyl)pyrido[3,2-b]indol-7-yl]methanol |
|---|---|
| PubChem CID | 138527836 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | [3-[(Z)-2-amino-1-(methylamino)prop-1-enyl]-5-(oxan-4-ylmethyl)pyrido[3,2-b]indol-7-yl]methanol |
| SMILES | CN/C(=C(/C)N)c1cnc2c3ccc(CO)cc3n(CC3CCOCC3)c2c1 |
| InChI | InChI=1S/C22H28N4O2/c1-14(23)21(24-2)17-10-20-22(25-11-17)18-4-3-16(13-27)9-19(18)26(20)12-15-5-7-28-8-6-15/h3-4,9-11,15,24,27H,5-8,12-13,23H2,1-2H3/b21-14- |
| InChIKey | PEWUKKWXMVUTMX-STZFKDTASA-N |
| XLogP | 2.97 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|