C31H41N5O3 — CID 144877531
2-[3-[(E)-2-amino-1-[amino(methyl)amino]-2-ethoxyethenyl]-5-(oxan-4-ylmethyl)pyrido[3,2-b]indol-7-yl]propan-2-ol;benzene (PubChem CID 144877531) has the molecular formula C31H41N5O3 and a molecular weight of 531.70 g/mol. Its IUPAC name is 2-[3-[(E)-2-amino-1-[amino(methyl)amino]-2-ethoxyethenyl]-5-(oxan-4-ylmethyl)pyrido[3,2-b]indol-7-yl]propan-2-ol;benzene.
| Compound Name | 2-[3-[(E)-2-amino-1-[amino(methyl)amino]-2-ethoxyethenyl]-5-(oxan-4-ylmethyl)pyrido[3,2-b]indol-7-yl]propan-2-ol;benzene |
|---|---|
| PubChem CID | 144877531 |
| Molecular Formula | C31H41N5O3 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.32 |
| IUPAC Name | 2-[3-[(E)-2-amino-1-[amino(methyl)amino]-2-ethoxyethenyl]-5-(oxan-4-ylmethyl)pyrido[3,2-b]indol-7-yl]propan-2-ol;benzene |
| SMILES | CCO/C(N)=C(\c1cnc2c3ccc(C(C)(C)O)cc3n(CC3CCOCC3)c2c1)N(C)N.c1ccccc1 |
| InChI | InChI=1S/C25H35N5O3.C6H6/c1-5-33-24(26)23(29(4)27)17-12-21-22(28-14-17)19-7-6-18(25(2,3)31)13-20(19)30(21)15-16-8-10-32-11-9-16;1-2-4-6-5-3-1/h6-7,12-14,16,31H,5,8-11,15,26-27H2,1-4H3;1-6H/b24-23+; |
| InChIKey | LLJUXLMLFVGWJS-XMXXDQCKSA-N |
| XLogP | 4.96 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|