C30H39N5O3 — CID 144877538
2-[3-[(E)-2-amino-1-[amino(methyl)amino]-2-methoxyethenyl]-5-(oxan-4-ylmethyl)pyrido[3,2-b]indol-7-yl]propan-2-ol;benzene (PubChem CID 144877538) has the molecular formula C30H39N5O3 and a molecular weight of 517.67 g/mol. Its IUPAC name is 2-[3-[(E)-2-amino-1-[amino(methyl)amino]-2-methoxyethenyl]-5-(oxan-4-ylmethyl)pyrido[3,2-b]indol-7-yl]propan-2-ol;benzene.
| Compound Name | 2-[3-[(E)-2-amino-1-[amino(methyl)amino]-2-methoxyethenyl]-5-(oxan-4-ylmethyl)pyrido[3,2-b]indol-7-yl]propan-2-ol;benzene |
|---|---|
| PubChem CID | 144877538 |
| Molecular Formula | C30H39N5O3 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.31 |
| IUPAC Name | 2-[3-[(E)-2-amino-1-[amino(methyl)amino]-2-methoxyethenyl]-5-(oxan-4-ylmethyl)pyrido[3,2-b]indol-7-yl]propan-2-ol;benzene |
| SMILES | CO/C(N)=C(\c1cnc2c3ccc(C(C)(C)O)cc3n(CC3CCOCC3)c2c1)N(C)N.c1ccccc1 |
| InChI | InChI=1S/C24H33N5O3.C6H6/c1-24(2,30)17-5-6-18-19(12-17)29(14-15-7-9-32-10-8-15)20-11-16(13-27-21(18)20)22(28(3)26)23(25)31-4;1-2-4-6-5-3-1/h5-6,11-13,15,30H,7-10,14,25-26H2,1-4H3;1-6H/b23-22+; |
| InChIKey | SIGNZDSVQOPKCU-PGCQSHBKSA-N |
| XLogP | 4.57 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|