C24H34N6O3 — CID 139354803
2-[5-[(Z)-2-amino-1-[amino(methyl)amino]prop-1-enyl]-13-methoxy-8-(oxan-4-ylmethyl)-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-10-yl]propan-2-ol (PubChem CID 139354803) has the molecular formula C24H34N6O3 and a molecular weight of 454.58 g/mol. Its IUPAC name is 2-[5-[(Z)-2-amino-1-[amino(methyl)amino]prop-1-enyl]-13-methoxy-8-(oxan-4-ylmethyl)-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-10-yl]propan-2-ol.
| Compound Name | 2-[5-[(Z)-2-amino-1-[amino(methyl)amino]prop-1-enyl]-13-methoxy-8-(oxan-4-ylmethyl)-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-10-yl]propan-2-ol |
|---|---|
| PubChem CID | 139354803 |
| Molecular Formula | C24H34N6O3 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 2-[5-[(Z)-2-amino-1-[amino(methyl)amino]prop-1-enyl]-13-methoxy-8-(oxan-4-ylmethyl)-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-10-yl]propan-2-ol |
| SMILES | COc1ncc(C(C)(C)O)c2c1c1ncc(/C(=C(\C)N)N(C)N)cc1n2CC1CCOCC1 |
| InChI | InChI=1S/C24H34N6O3/c1-14(25)21(29(4)26)16-10-18-20(27-11-16)19-22(30(18)13-15-6-8-33-9-7-15)17(24(2,3)31)12-28-23(19)32-5/h10-12,15,31H,6-9,13,25-26H2,1-5H3/b21-14- |
| InChIKey | QESOKUGIJBKLLL-STZFKDTASA-N |
| XLogP | 2.70 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|