C31H41Cl2N5O2 — CID 144877574
2-[3-[(E)-2-amino-1-[amino(methyl)amino]-2-chloroethenyl]-8-chloro-5-(oxan-4-ylmethyl)pyrido[3,2-b]indol-7-yl]propan-2-ol;benzene;ethane (PubChem CID 144877574) has the molecular formula C31H41Cl2N5O2 and a molecular weight of 586.61 g/mol. Its IUPAC name is 2-[3-[(E)-2-amino-1-[amino(methyl)amino]-2-chloroethenyl]-8-chloro-5-(oxan-4-ylmethyl)pyrido[3,2-b]indol-7-yl]propan-2-ol;benzene;ethane.
| Compound Name | 2-[3-[(E)-2-amino-1-[amino(methyl)amino]-2-chloroethenyl]-8-chloro-5-(oxan-4-ylmethyl)pyrido[3,2-b]indol-7-yl]propan-2-ol;benzene;ethane |
|---|---|
| PubChem CID | 144877574 |
| Molecular Formula | C31H41Cl2N5O2 |
| Molecular Weight | 586.61 g/mol |
| Exact Mass | 585.26 |
| IUPAC Name | 2-[3-[(E)-2-amino-1-[amino(methyl)amino]-2-chloroethenyl]-8-chloro-5-(oxan-4-ylmethyl)pyrido[3,2-b]indol-7-yl]propan-2-ol;benzene;ethane |
| SMILES | CC.CN(N)/C(=C(\N)Cl)c1cnc2c3cc(Cl)c(C(C)(C)O)cc3n(CC3CCOCC3)c2c1.c1ccccc1 |
| InChI | InChI=1S/C23H29Cl2N5O2.C6H6.C2H6/c1-23(2,31)16-10-18-15(9-17(16)24)20-19(30(18)12-13-4-6-32-7-5-13)8-14(11-28-20)21(22(25)26)29(3)27;1-2-4-6-5-3-1;1-2/h8-11,13,31H,4-7,12,26-27H2,1-3H3;1-6H;1-2H3/b22-21-;; |
| InChIKey | VQRAVDCXZVEDNM-RKFQPGFBSA-N |
| XLogP | 6.84 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.61 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|