C28H41N7O2 — CID 139354724
2-[1-[5-[(Z)-2-amino-1-[amino(methyl)amino]prop-1-enyl]-8-(oxan-4-ylmethyl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]piperidin-4-yl]propan-2-ol (PubChem CID 139354724) has the molecular formula C28H41N7O2 and a molecular weight of 507.68 g/mol. Its IUPAC name is 2-[1-[5-[(Z)-2-amino-1-[amino(methyl)amino]prop-1-enyl]-8-(oxan-4-ylmethyl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]piperidin-4-yl]propan-2-ol.
| Compound Name | 2-[1-[5-[(Z)-2-amino-1-[amino(methyl)amino]prop-1-enyl]-8-(oxan-4-ylmethyl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]piperidin-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 139354724 |
| Molecular Formula | C28H41N7O2 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.33 |
| IUPAC Name | 2-[1-[5-[(Z)-2-amino-1-[amino(methyl)amino]prop-1-enyl]-8-(oxan-4-ylmethyl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]piperidin-4-yl]propan-2-ol |
| SMILES | C/C(N)=C(\c1cnc2c3ccc(N4CCC(C(C)(C)O)CC4)nc3n(CC3CCOCC3)c2c1)N(C)N |
| InChI | InChI=1S/C28H41N7O2/c1-18(29)26(33(4)30)20-15-23-25(31-16-20)22-5-6-24(34-11-7-21(8-12-34)28(2,3)36)32-27(22)35(23)17-19-9-13-37-14-10-19/h5-6,15-16,19,21,36H,7-14,17,29-30H2,1-4H3/b26-18- |
| InChIKey | LSEGOGPWJVBWDP-ITYLOYPMSA-N |
| XLogP | 3.45 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|