C26H30N6O2S — CID 139354705
1-[5-[5-[(Z)-2-amino-1-[amino(methyl)amino]prop-1-enyl]-8-(oxan-4-ylmethyl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]thiophen-2-yl]ethanone (PubChem CID 139354705) has the molecular formula C26H30N6O2S and a molecular weight of 490.63 g/mol. Its IUPAC name is 1-[5-[5-[(Z)-2-amino-1-[amino(methyl)amino]prop-1-enyl]-8-(oxan-4-ylmethyl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]thiophen-2-yl]ethanone.
| Compound Name | 1-[5-[5-[(Z)-2-amino-1-[amino(methyl)amino]prop-1-enyl]-8-(oxan-4-ylmethyl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 139354705 |
| Molecular Formula | C26H30N6O2S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 1-[5-[5-[(Z)-2-amino-1-[amino(methyl)amino]prop-1-enyl]-8-(oxan-4-ylmethyl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]thiophen-2-yl]ethanone |
| SMILES | CC(=O)c1ccc(-c2ccc3c4ncc(/C(=C(\C)N)N(C)N)cc4n(CC4CCOCC4)c3n2)s1 |
| InChI | InChI=1S/C26H30N6O2S/c1-15(27)25(31(3)28)18-12-21-24(29-13-18)19-4-5-20(23-7-6-22(35-23)16(2)33)30-26(19)32(21)14-17-8-10-34-11-9-17/h4-7,12-13,17H,8-11,14,27-28H2,1-3H3/b25-15- |
| InChIKey | PMXNCLMERPVTHF-MYYYXRDXSA-N |
| XLogP | 4.39 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|