C33H48N8O3 — CID 145187501
(E)-2-[3-[(E)-2-amino-1-[amino(methyl)amino]-2-methoxyethenyl]-5-(oxan-4-ylmethyl)pyrido[3,2-b]indol-7-yl]-2-[amino(methyl)amino]-1-methoxyethenamine;benzene;ethane (PubChem CID 145187501) has the molecular formula C33H48N8O3 and a molecular weight of 604.80 g/mol. Its IUPAC name is (E)-2-[3-[(E)-2-amino-1-[amino(methyl)amino]-2-methoxyethenyl]-5-(oxan-4-ylmethyl)pyrido[3,2-b]indol-7-yl]-2-[amino(methyl)amino]-1-methoxyethenamine;benzene;ethane.
| Compound Name | (E)-2-[3-[(E)-2-amino-1-[amino(methyl)amino]-2-methoxyethenyl]-5-(oxan-4-ylmethyl)pyrido[3,2-b]indol-7-yl]-2-[amino(methyl)amino]-1-methoxyethenamine;benzene;ethane |
|---|---|
| PubChem CID | 145187501 |
| Molecular Formula | C33H48N8O3 |
| Molecular Weight | 604.80 g/mol |
| Exact Mass | 604.38 |
| IUPAC Name | (E)-2-[3-[(E)-2-amino-1-[amino(methyl)amino]-2-methoxyethenyl]-5-(oxan-4-ylmethyl)pyrido[3,2-b]indol-7-yl]-2-[amino(methyl)amino]-1-methoxyethenamine;benzene;ethane |
| SMILES | CC.CO/C(N)=C(\c1ccc2c3ncc(/C(=C(/N)OC)N(C)N)cc3n(CC3CCOCC3)c2c1)N(C)N.c1ccccc1 |
| InChI | InChI=1S/C25H36N8O3.C6H6.C2H6/c1-31(28)22(24(26)34-3)16-5-6-18-19(11-16)33(14-15-7-9-36-10-8-15)20-12-17(13-30-21(18)20)23(32(2)29)25(27)35-4;1-2-4-6-5-3-1;1-2/h5-6,11-13,15H,7-10,14,26-29H2,1-4H3;1-6H;1-2H3/b24-22+,25-23+;; |
| InChIKey | AVOQWPOVHGRYAA-WUROJHRBSA-N |
| XLogP | 4.40 |
| TPSA | 156.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.80 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|