C32H41N7O3S — CID 145187631
(Z)-1-[amino(methyl)amino]-1-[11-(4-methylsulfonylpiperidin-1-yl)-8-[oxan-4-yl(phenyl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine (PubChem CID 145187631) has the molecular formula C32H41N7O3S and a molecular weight of 603.79 g/mol. Its IUPAC name is (Z)-1-[amino(methyl)amino]-1-[11-(4-methylsulfonylpiperidin-1-yl)-8-[oxan-4-yl(phenyl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine.
| Compound Name | (Z)-1-[amino(methyl)amino]-1-[11-(4-methylsulfonylpiperidin-1-yl)-8-[oxan-4-yl(phenyl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine |
|---|---|
| PubChem CID | 145187631 |
| Molecular Formula | C32H41N7O3S |
| Molecular Weight | 603.79 g/mol |
| Exact Mass | 603.30 |
| IUPAC Name | (Z)-1-[amino(methyl)amino]-1-[11-(4-methylsulfonylpiperidin-1-yl)-8-[oxan-4-yl(phenyl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine |
| SMILES | C/C(N)=C(\c1cnc2c3ccc(N4CCC(S(C)(=O)=O)CC4)nc3n(C(c3ccccc3)C3CCOCC3)c2c1)N(C)N |
| InChI | InChI=1S/C32H41N7O3S/c1-21(33)30(37(2)34)24-19-27-29(35-20-24)26-9-10-28(38-15-11-25(12-16-38)43(3,40)41)36-32(26)39(27)31(22-7-5-4-6-8-22)23-13-17-42-18-14-23/h4-10,19-20,23,25,31H,11-18,33-34H2,1-3H3/b30-21- |
| InChIKey | OOVCQJOQFLHXKU-OFWBYEQRSA-N |
| XLogP | 4.07 |
| TPSA | 132.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.79 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|