C30H39N7O2 — CID 139354788
(Z)-1-[amino(methyl)amino]-1-[10-[2-(dimethylamino)ethoxy]-8-[oxan-4-yl(phenyl)methyl]-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine (PubChem CID 139354788) has the molecular formula C30H39N7O2 and a molecular weight of 529.69 g/mol. Its IUPAC name is (Z)-1-[amino(methyl)amino]-1-[10-[2-(dimethylamino)ethoxy]-8-[oxan-4-yl(phenyl)methyl]-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine.
| Compound Name | (Z)-1-[amino(methyl)amino]-1-[10-[2-(dimethylamino)ethoxy]-8-[oxan-4-yl(phenyl)methyl]-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine |
|---|---|
| PubChem CID | 139354788 |
| Molecular Formula | C30H39N7O2 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.32 |
| IUPAC Name | (Z)-1-[amino(methyl)amino]-1-[10-[2-(dimethylamino)ethoxy]-8-[oxan-4-yl(phenyl)methyl]-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine |
| SMILES | C/C(N)=C(\c1cnc2c3ccnc(OCCN(C)C)c3n(C(c3ccccc3)C3CCOCC3)c2c1)N(C)N |
| InChI | InChI=1S/C30H39N7O2/c1-20(31)27(36(4)32)23-18-25-26(34-19-23)24-10-13-33-30(39-17-14-35(2)3)29(24)37(25)28(21-8-6-5-7-9-21)22-11-15-38-16-12-22/h5-10,13,18-19,22,28H,11-12,14-17,31-32H2,1-4H3/b27-20- |
| InChIKey | ZPMYYIWGUCYLME-OOAXWGSJSA-N |
| XLogP | 3.99 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|