C27H31F2N6O2+ — CID 149324852
1-[amino(methyl)amino]-1-[8-[(2,3-difluorophenyl)-(oxan-4-yl)methyl]-10-methoxy-3,8-diaza-11-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine (PubChem CID 149324852) has the molecular formula C27H31F2N6O2+ and a molecular weight of 509.58 g/mol. Its IUPAC name is 1-[amino(methyl)amino]-1-[8-[(2,3-difluorophenyl)-(oxan-4-yl)methyl]-10-methoxy-3,8-diaza-11-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine.
| Compound Name | 1-[amino(methyl)amino]-1-[8-[(2,3-difluorophenyl)-(oxan-4-yl)methyl]-10-methoxy-3,8-diaza-11-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine |
|---|---|
| PubChem CID | 149324852 |
| Molecular Formula | C27H31F2N6O2+ |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | 1-[amino(methyl)amino]-1-[8-[(2,3-difluorophenyl)-(oxan-4-yl)methyl]-10-methoxy-3,8-diaza-11-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine |
| SMILES | COc1[nH+]ccc2c3ncc(C(=C(C)N)N(C)N)cc3n(C(c3cccc(F)c3F)C3CCOCC3)c12 |
| InChI | InChI=1S/C27H30F2N6O2/c1-15(30)24(34(2)31)17-13-21-23(33-14-17)19-7-10-32-27(36-3)26(19)35(21)25(16-8-11-37-12-9-16)18-5-4-6-20(28)22(18)29/h4-7,10,13-14,16,25H,8-9,11-12,30-31H2,1-3H3/p+1 |
| InChIKey | YBDZDLCBJGRNNM-UHFFFAOYSA-O |
| XLogP | 3.76 |
| TPSA | 105.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|