C27H30F2N6O2 — CID 139354765
(Z)-1-[amino(methyl)amino]-1-[8-[(2,4-difluorophenyl)-(oxan-4-yl)methyl]-10-methoxy-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine (PubChem CID 139354765) has the molecular formula C27H30F2N6O2 and a molecular weight of 508.57 g/mol. Its IUPAC name is (Z)-1-[amino(methyl)amino]-1-[8-[(2,4-difluorophenyl)-(oxan-4-yl)methyl]-10-methoxy-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine.
| Compound Name | (Z)-1-[amino(methyl)amino]-1-[8-[(2,4-difluorophenyl)-(oxan-4-yl)methyl]-10-methoxy-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine |
|---|---|
| PubChem CID | 139354765 |
| Molecular Formula | C27H30F2N6O2 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | (Z)-1-[amino(methyl)amino]-1-[8-[(2,4-difluorophenyl)-(oxan-4-yl)methyl]-10-methoxy-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl]prop-1-en-2-amine |
| SMILES | COc1nccc2c3ncc(/C(=C(\C)N)N(C)N)cc3n(C(c3ccc(F)cc3F)C3CCOCC3)c12 |
| InChI | InChI=1S/C27H30F2N6O2/c1-15(30)24(34(2)31)17-12-22-23(33-14-17)20-6-9-32-27(36-3)26(20)35(22)25(16-7-10-37-11-8-16)19-5-4-18(28)13-21(19)29/h4-6,9,12-14,16,25H,7-8,10-11,30-31H2,1-3H3/b24-15- |
| InChIKey | QOKRCIIMFAYJDY-IWIPYMOSSA-N |
| XLogP | 4.34 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|