C34H43FN6O2 — CID 155183223
2-[3-[(Z)-2-amino-1-[amino(methyl)amino]prop-1-enyl]-5-[1-(3-fluorophenyl)-2-[1-(oxetan-3-yl)piperidin-4-yl]ethyl]pyrido[3,2-b]indol-7-yl]propan-2-ol (PubChem CID 155183223) has the molecular formula C34H43FN6O2 and a molecular weight of 586.76 g/mol. Its IUPAC name is 2-[3-[(Z)-2-amino-1-[amino(methyl)amino]prop-1-enyl]-5-[1-(3-fluorophenyl)-2-[1-(oxetan-3-yl)piperidin-4-yl]ethyl]pyrido[3,2-b]indol-7-yl]propan-2-ol.
| Compound Name | 2-[3-[(Z)-2-amino-1-[amino(methyl)amino]prop-1-enyl]-5-[1-(3-fluorophenyl)-2-[1-(oxetan-3-yl)piperidin-4-yl]ethyl]pyrido[3,2-b]indol-7-yl]propan-2-ol |
|---|---|
| PubChem CID | 155183223 |
| Molecular Formula | C34H43FN6O2 |
| Molecular Weight | 586.76 g/mol |
| Exact Mass | 586.34 |
| IUPAC Name | 2-[3-[(Z)-2-amino-1-[amino(methyl)amino]prop-1-enyl]-5-[1-(3-fluorophenyl)-2-[1-(oxetan-3-yl)piperidin-4-yl]ethyl]pyrido[3,2-b]indol-7-yl]propan-2-ol |
| SMILES | C/C(N)=C(\c1cnc2c3ccc(C(C)(C)O)cc3n(C(CC3CCN(C4COC4)CC3)c3cccc(F)c3)c2c1)N(C)N |
| InChI | InChI=1S/C34H43FN6O2/c1-21(36)33(39(4)37)24-16-31-32(38-18-24)28-9-8-25(34(2,3)42)17-30(28)41(31)29(23-6-5-7-26(35)15-23)14-22-10-12-40(13-11-22)27-19-43-20-27/h5-9,15-18,22,27,29,42H,10-14,19-20,36-37H2,1-4H3/b33-21- |
| InChIKey | PBMLBLMSAKHBHG-HWIUFGAZSA-N |
| XLogP | 5.10 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.76 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|