C24H22BrN3O3 — CID 122686569
methyl 5-bromo-8-[oxan-4-yl(phenyl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-12-carboxylate (PubChem CID 122686569) has the molecular formula C24H22BrN3O3 and a molecular weight of 480.36 g/mol. Its IUPAC name is methyl 5-bromo-8-[oxan-4-yl(phenyl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-12-carboxylate.
| Compound Name | methyl 5-bromo-8-[oxan-4-yl(phenyl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-12-carboxylate |
|---|---|
| PubChem CID | 122686569 |
| Molecular Formula | C24H22BrN3O3 |
| Molecular Weight | 480.36 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | methyl 5-bromo-8-[oxan-4-yl(phenyl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-12-carboxylate |
| SMILES | COC(=O)c1cnc2c(c1)c1ncc(Br)cc1n2C(c1ccccc1)C1CCOCC1 |
| InChI | InChI=1S/C24H22BrN3O3/c1-30-24(29)17-11-19-21-20(12-18(25)14-26-21)28(23(19)27-13-17)22(15-5-3-2-4-6-15)16-7-9-31-10-8-16/h2-6,11-14,16,22H,7-10H2,1H3 |
| InChIKey | JGNKPJAMALODQE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.36 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |