C25H24BrN3O4 — CID 122687323
methyl 5-bromo-13-methoxy-8-[oxan-4-yl(phenyl)methyl]-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-10-carboxylate (PubChem CID 122687323) has the molecular formula C25H24BrN3O4 and a molecular weight of 510.39 g/mol. Its IUPAC name is methyl 5-bromo-13-methoxy-8-[oxan-4-yl(phenyl)methyl]-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-10-carboxylate.
| Compound Name | methyl 5-bromo-13-methoxy-8-[oxan-4-yl(phenyl)methyl]-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-10-carboxylate |
|---|---|
| PubChem CID | 122687323 |
| Molecular Formula | C25H24BrN3O4 |
| Molecular Weight | 510.39 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | methyl 5-bromo-13-methoxy-8-[oxan-4-yl(phenyl)methyl]-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-10-carboxylate |
| SMILES | COC(=O)c1cnc(OC)c2c3ncc(Br)cc3n(C(c3ccccc3)C3CCOCC3)c12 |
| InChI | InChI=1S/C25H24BrN3O4/c1-31-24-20-21-19(12-17(26)13-27-21)29(23(20)18(14-28-24)25(30)32-2)22(15-6-4-3-5-7-15)16-8-10-33-11-9-16/h3-7,12-14,16,22H,8-11H2,1-2H3 |
| InChIKey | VOMYNOSOMOXPQE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.39 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |