C25H48N2O9 — CID 122688280
5-[2-[2-[2-[2-[2-[2-[3-(2-prop-2-ynoxyethylamino)propoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]pentanoic acid (PubChem CID 122688280) has the molecular formula C25H48N2O9 and a molecular weight of 520.66 g/mol. Its IUPAC name is 5-[2-[2-[2-[2-[2-[2-[3-(2-prop-2-ynoxyethylamino)propoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]pentanoic acid.
| Compound Name | 5-[2-[2-[2-[2-[2-[2-[3-(2-prop-2-ynoxyethylamino)propoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]pentanoic acid |
|---|---|
| PubChem CID | 122688280 |
| Molecular Formula | C25H48N2O9 |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.34 |
| IUPAC Name | 5-[2-[2-[2-[2-[2-[2-[3-(2-prop-2-ynoxyethylamino)propoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]pentanoic acid |
| SMILES | C#CCOCCNCCCOCCOCCOCCOCCOCCOCCNCCCCC(=O)O |
| InChI | InChI=1S/C25H48N2O9/c1-2-11-30-13-9-27-8-5-12-31-15-17-33-19-21-35-23-24-36-22-20-34-18-16-32-14-10-26-7-4-3-6-25(28)29/h1,26-27H,3-24H2,(H,28,29) |
| InChIKey | HBENQGQOCVGQCN-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 125.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|