C37H56N4O14S — CID 122690198
3-[4-[[2,4-bis[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrimidin-5-yl]methyl]-2,6-dimethoxyphenoxy]propyl methanesulfonate (PubChem CID 122690198) has the molecular formula C37H56N4O14S and a molecular weight of 812.94 g/mol. Its IUPAC name is 3-[4-[[2,4-bis[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrimidin-5-yl]methyl]-2,6-dimethoxyphenoxy]propyl methanesulfonate.
| Compound Name | 3-[4-[[2,4-bis[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrimidin-5-yl]methyl]-2,6-dimethoxyphenoxy]propyl methanesulfonate |
|---|---|
| PubChem CID | 122690198 |
| Molecular Formula | C37H56N4O14S |
| Molecular Weight | 812.94 g/mol |
| Exact Mass | 812.35 |
| IUPAC Name | 3-[4-[[2,4-bis[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrimidin-5-yl]methyl]-2,6-dimethoxyphenoxy]propyl methanesulfonate |
| SMILES | COc1cc(Cc2cnc(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)nc2N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc(OC)c1OCCCOS(C)(=O)=O |
| InChI | InChI=1S/C37H56N4O14S/c1-34(2,3)52-30(42)40(31(43)53-35(4,5)6)28-24(22-38-29(39-28)41(32(44)54-36(7,8)9)33(45)55-37(10,11)12)19-23-20-25(48-13)27(26(21-23)49-14)50-17-16-18-51-56(15,46)47/h20-22H,16-19H2,1-15H3 |
| InChIKey | INURVRNTVXATOD-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 208.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.94 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|