C20H13F2N3O2 — CID 122690335
6-fluoro-2-[4-(2-fluorophenyl)phenyl]-N-hydroxy-1H-benzimidazole-5-carboxamide (PubChem CID 122690335) has the molecular formula C20H13F2N3O2 and a molecular weight of 365.34 g/mol. Its IUPAC name is 6-fluoro-2-[4-(2-fluorophenyl)phenyl]-N-hydroxy-1H-benzimidazole-5-carboxamide.
| Compound Name | 6-fluoro-2-[4-(2-fluorophenyl)phenyl]-N-hydroxy-1H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 122690335 |
| Molecular Formula | C20H13F2N3O2 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 6-fluoro-2-[4-(2-fluorophenyl)phenyl]-N-hydroxy-1H-benzimidazole-5-carboxamide |
| SMILES | O=C(NO)c1cc2nc(-c3ccc(-c4ccccc4F)cc3)[nH]c2cc1F |
| InChI | InChI=1S/C20H13F2N3O2/c21-15-4-2-1-3-13(15)11-5-7-12(8-6-11)19-23-17-9-14(20(26)25-27)16(22)10-18(17)24-19/h1-10,27H,(H,23,24)(H,25,26) |
| InChIKey | DZYLJHYJUZYAGN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|