C19H14FN3O2S — CID 52941877
2-[4-(2-fluorophenyl)phenyl]-3H-benzimidazole-5-sulfonamide (PubChem CID 52941877) has the molecular formula C19H14FN3O2S and a molecular weight of 367.41 g/mol. Its IUPAC name is 2-[4-(2-fluorophenyl)phenyl]-3H-benzimidazole-5-sulfonamide.
| Compound Name | 2-[4-(2-fluorophenyl)phenyl]-3H-benzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 52941877 |
| Molecular Formula | C19H14FN3O2S |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 2-[4-(2-fluorophenyl)phenyl]-3H-benzimidazole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2nc(-c3ccc(-c4ccccc4F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C19H14FN3O2S/c20-16-4-2-1-3-15(16)12-5-7-13(8-6-12)19-22-17-10-9-14(26(21,24)25)11-18(17)23-19/h1-11H,(H,22,23)(H2,21,24,25) |
| InChIKey | BITOVZIDEAIQGL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |