C18H12ClN3O3 — CID 122690364
2-[5-(3-chlorophenyl)furan-2-yl]-N-hydroxy-3H-benzimidazole-5-carboxamide (PubChem CID 122690364) has the molecular formula C18H12ClN3O3 and a molecular weight of 353.77 g/mol. Its IUPAC name is 2-[5-(3-chlorophenyl)furan-2-yl]-N-hydroxy-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-[5-(3-chlorophenyl)furan-2-yl]-N-hydroxy-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 122690364 |
| Molecular Formula | C18H12ClN3O3 |
| Molecular Weight | 353.77 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 2-[5-(3-chlorophenyl)furan-2-yl]-N-hydroxy-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(NO)c1ccc2nc(-c3ccc(-c4cccc(Cl)c4)o3)[nH]c2c1 |
| InChI | InChI=1S/C18H12ClN3O3/c19-12-3-1-2-10(8-12)15-6-7-16(25-15)17-20-13-5-4-11(18(23)22-24)9-14(13)21-17/h1-9,24H,(H,20,21)(H,22,23) |
| InChIKey | ZNHQJHKSPQJNKJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.77 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|