C21H23F2N5O2S — CID 122691440
5-amino-N-[1-[4-(1,1-difluoroethoxy)phenyl]pyrrolidin-3-yl]-3,4-dimethylthieno[2,3-c]pyridazine-6-carboxamide (PubChem CID 122691440) has the molecular formula C21H23F2N5O2S and a molecular weight of 447.51 g/mol. Its IUPAC name is 5-amino-N-[1-[4-(1,1-difluoroethoxy)phenyl]pyrrolidin-3-yl]-3,4-dimethylthieno[2,3-c]pyridazine-6-carboxamide.
| Compound Name | 5-amino-N-[1-[4-(1,1-difluoroethoxy)phenyl]pyrrolidin-3-yl]-3,4-dimethylthieno[2,3-c]pyridazine-6-carboxamide |
|---|---|
| PubChem CID | 122691440 |
| Molecular Formula | C21H23F2N5O2S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 5-amino-N-[1-[4-(1,1-difluoroethoxy)phenyl]pyrrolidin-3-yl]-3,4-dimethylthieno[2,3-c]pyridazine-6-carboxamide |
| SMILES | Cc1nnc2sc(C(=O)NC3CCN(c4ccc(OC(C)(F)F)cc4)C3)c(N)c2c1C |
| InChI | InChI=1S/C21H23F2N5O2S/c1-11-12(2)26-27-20-16(11)17(24)18(31-20)19(29)25-13-8-9-28(10-13)14-4-6-15(7-5-14)30-21(3,22)23/h4-7,13H,8-10,24H2,1-3H3,(H,25,29) |
| InChIKey | WZMKPPOBQNYIMX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|