C20H22F3N5O2S — CID 126496409
(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[[1-[4-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]amino]methanol (PubChem CID 126496409) has the molecular formula C20H22F3N5O2S and a molecular weight of 453.49 g/mol. Its IUPAC name is (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[[1-[4-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]amino]methanol.
| Compound Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[[1-[4-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]amino]methanol |
|---|---|
| PubChem CID | 126496409 |
| Molecular Formula | C20H22F3N5O2S |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[[1-[4-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]amino]methanol |
| SMILES | Cc1nnc2sc(C(O)NC3CCN(c4ccc(OC(F)(F)F)cc4)C3)c(N)c2c1C |
| InChI | InChI=1S/C20H22F3N5O2S/c1-10-11(2)26-27-19-15(10)16(24)17(31-19)18(29)25-12-7-8-28(9-12)13-3-5-14(6-4-13)30-20(21,22)23/h3-6,12,18,25,29H,7-9,24H2,1-2H3 |
| InChIKey | HMQNGOBPIKJBLM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|