C19H25N5O3 — CID 122693308
N-[5-[(3-ethylphenyl)carbamoyl]-1-methylpyrazol-3-yl]-4-hydroxypiperidine-1-carboxamide (PubChem CID 122693308) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[5-[(3-ethylphenyl)carbamoyl]-1-methylpyrazol-3-yl]-4-hydroxypiperidine-1-carboxamide.
| Compound Name | N-[5-[(3-ethylphenyl)carbamoyl]-1-methylpyrazol-3-yl]-4-hydroxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 122693308 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | N-[5-[(3-ethylphenyl)carbamoyl]-1-methylpyrazol-3-yl]-4-hydroxypiperidine-1-carboxamide |
| SMILES | CCc1cccc(NC(=O)c2cc(NC(=O)N3CCC(O)CC3)nn2C)c1 |
| InChI | InChI=1S/C19H25N5O3/c1-3-13-5-4-6-14(11-13)20-18(26)16-12-17(22-23(16)2)21-19(27)24-9-7-15(25)8-10-24/h4-6,11-12,15,25H,3,7-10H2,1-2H3,(H,20,26)(H,21,22,27) |
| InChIKey | ATBDUCLCYZYKQI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |