C19H25N5O5 — CID 145187825
3-[[3-[(4-hydroxypiperidine-1-carbonyl)amino]-1-methylpyrazol-5-yl]methoxymethylamino]benzoic acid (PubChem CID 145187825) has the molecular formula C19H25N5O5 and a molecular weight of 403.44 g/mol. Its IUPAC name is 3-[[3-[(4-hydroxypiperidine-1-carbonyl)amino]-1-methylpyrazol-5-yl]methoxymethylamino]benzoic acid.
| Compound Name | 3-[[3-[(4-hydroxypiperidine-1-carbonyl)amino]-1-methylpyrazol-5-yl]methoxymethylamino]benzoic acid |
|---|---|
| PubChem CID | 145187825 |
| Molecular Formula | C19H25N5O5 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 3-[[3-[(4-hydroxypiperidine-1-carbonyl)amino]-1-methylpyrazol-5-yl]methoxymethylamino]benzoic acid |
| SMILES | Cn1nc(NC(=O)N2CCC(O)CC2)cc1COCNc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C19H25N5O5/c1-23-15(11-29-12-20-14-4-2-3-13(9-14)18(26)27)10-17(22-23)21-19(28)24-7-5-16(25)6-8-24/h2-4,9-10,16,20,25H,5-8,11-12H2,1H3,(H,26,27)(H,21,22,28) |
| InChIKey | DNMHMONDBRGTAA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 128.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|