C11H10FNO5S — CID 122693538
2-[(5-fluoro-1-benzofuran-2-yl)sulfonyl-methylamino]acetic acid (PubChem CID 122693538) has the molecular formula C11H10FNO5S and a molecular weight of 287.27 g/mol. Its IUPAC name is 2-[(5-fluoro-1-benzofuran-2-yl)sulfonyl-methylamino]acetic acid.
| Compound Name | 2-[(5-fluoro-1-benzofuran-2-yl)sulfonyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 122693538 |
| Molecular Formula | C11H10FNO5S |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 2-[(5-fluoro-1-benzofuran-2-yl)sulfonyl-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)S(=O)(=O)c1cc2cc(F)ccc2o1 |
| InChI | InChI=1S/C11H10FNO5S/c1-13(6-10(14)15)19(16,17)11-5-7-4-8(12)2-3-9(7)18-11/h2-5H,6H2,1H3,(H,14,15) |
| InChIKey | UVPQWGMKLMICRM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |