C15H27N — CID 122694989
4-tert-butyl-5-(2,3,3-trimethylbutan-2-yl)-2H-pyrrole (PubChem CID 122694989) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is 4-tert-butyl-5-(2,3,3-trimethylbutan-2-yl)-2H-pyrrole.
| Compound Name | 4-tert-butyl-5-(2,3,3-trimethylbutan-2-yl)-2H-pyrrole |
|---|---|
| PubChem CID | 122694989 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 4-tert-butyl-5-(2,3,3-trimethylbutan-2-yl)-2H-pyrrole |
| SMILES | CC(C)(C)C1=CCN=C1C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H27N/c1-13(2,3)11-9-10-16-12(11)15(7,8)14(4,5)6/h9H,10H2,1-8H3 |
| InChIKey | HGEQNEJMCWLLHE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |