C19H25N5S — CID 122695636
2-[(1R,12R,13R)-20-methyl-7-thia-5,20-diazapentacyclo[10.5.3.01,13.02,10.04,8]icosa-2,4(8),5,9-tetraen-6-yl]guanidine (PubChem CID 122695636) has the molecular formula C19H25N5S and a molecular weight of 355.51 g/mol. Its IUPAC name is 2-[(1R,12R,13R)-20-methyl-7-thia-5,20-diazapentacyclo[10.5.3.01,13.02,10.04,8]icosa-2,4(8),5,9-tetraen-6-yl]guanidine.
| Compound Name | 2-[(1R,12R,13R)-20-methyl-7-thia-5,20-diazapentacyclo[10.5.3.01,13.02,10.04,8]icosa-2,4(8),5,9-tetraen-6-yl]guanidine |
|---|---|
| PubChem CID | 122695636 |
| Molecular Formula | C19H25N5S |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 2-[(1R,12R,13R)-20-methyl-7-thia-5,20-diazapentacyclo[10.5.3.01,13.02,10.04,8]icosa-2,4(8),5,9-tetraen-6-yl]guanidine |
| SMILES | CN1CC[C@]23CCCC[C@H]2[C@H]1Cc1cc2sc(N=C(N)N)nc2cc13 |
| InChI | InChI=1S/C19H25N5S/c1-24-7-6-19-5-3-2-4-12(19)15(24)8-11-9-16-14(10-13(11)19)22-18(25-16)23-17(20)21/h9-10,12,15H,2-8H2,1H3,(H4,20,21,22,23)/t12-,15+,19+/m0/s1 |
| InChIKey | UVHUCUKOWJBUGQ-IOHHAYIISA-N |
| XLogP | 2.89 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|