About 1-propan-2-yl-5,6-dihydro-4H-thiopyrano[3,2-d]pyrazole 7-oxide
1-propan-2-yl-5,6-dihydro-4H-thiopyrano[3,2-d]pyrazole 7-oxide (PubChem CID 122696837) has the molecular formula C9H14N2OS
and a molecular weight of 198.29 g/mol. Its IUPAC name is 1-propan-2-yl-5,6-dihydro-4H-thiopyrano[3,2-d]pyrazole 7-oxide.
Analyze 1-propan-2-yl-5,6-dihydro-4H-thiopyrano[3,2-d]pyrazole 7-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yl-5,6-dihydro-4H-thiopyrano[3,2-d]pyrazole 7-oxide?
The IUPAC name of 1-propan-2-yl-5,6-dihydro-4H-thiopyrano[3,2-d]pyrazole 7-oxide (CID 122696837) is 1-propan-2-yl-5,6-dihydro-4H-thiopyrano[3,2-d]pyrazole 7-oxide.
What is the SMILES notation for 1-propan-2-yl-5,6-dihydro-4H-thiopyrano[3,2-d]pyrazole 7-oxide?
The canonical SMILES for 1-propan-2-yl-5,6-dihydro-4H-thiopyrano[3,2-d]pyrazole 7-oxide is CC(C)n1ncc2c1S(=O)CCC2.
What is the InChIKey of 1-propan-2-yl-5,6-dihydro-4H-thiopyrano[3,2-d]pyrazole 7-oxide?
The InChIKey is DMHUMHRDJDOKDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2OS/c1-7(2)11-9-8(6-10-11)4-3-5-13(9)12/h6-7H,3-5H2,1-2H3.
What are the key properties of 1-propan-2-yl-5,6-dihydro-4H-thiopyrano[3,2-d]pyrazole 7-oxide?
1-propan-2-yl-5,6-dihydro-4H-thiopyrano[3,2-d]pyrazole 7-oxide has a molecular weight of 198.29 g/mol, XLogP of 1.52, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yl-5,6-dihydro-4H-thiopyrano[3,2-d]pyrazole 7-oxide is sourced from PubChem (CID 122696837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).