C8H9N3OS — CID 122697086
3-propan-2-yl-[1,3]thiazolo[4,5-d]pyrimidin-2-one (PubChem CID 122697086) has the molecular formula C8H9N3OS and a molecular weight of 195.25 g/mol. Its IUPAC name is 3-propan-2-yl-[1,3]thiazolo[4,5-d]pyrimidin-2-one.
| Compound Name | 3-propan-2-yl-[1,3]thiazolo[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 122697086 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 3-propan-2-yl-[1,3]thiazolo[4,5-d]pyrimidin-2-one |
| SMILES | CC(C)n1c(=O)sc2cncnc21 |
| InChI | InChI=1S/C8H9N3OS/c1-5(2)11-7-6(13-8(11)12)3-9-4-10-7/h3-5H,1-2H3 |
| InChIKey | OGDVIVFKCYWOFH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |