About methane;9-propan-2-yl-8H-purin-8-ide;yttrium
methane;9-propan-2-yl-8H-purin-8-ide;yttrium (PubChem CID 157148419) has the molecular formula C9H13N4Y-
and a molecular weight of 266.14 g/mol. Its IUPAC name is methane;9-propan-2-yl-8H-purin-8-ide;yttrium.
Molecular Properties
| Compound Name | methane;9-propan-2-yl-8H-purin-8-ide;yttrium |
| PubChem CID | 157148419 |
| Molecular Formula | C9H13N4Y- |
| Molecular Weight | 266.14 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | methane;9-propan-2-yl-8H-purin-8-ide;yttrium |
| SMILES | C.CC(C)n1[c-]nc2cncnc21.[Y] |
| InChI | InChI=1S/C8H9N4.CH4.Y/c1-6(2)12-5-11-7-3-9-4-10-8(7)12;;/h3-4,6H,1-2H3;1H4;/q-1;; |
| InChIKey | CQNAQWXQMDJNCR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.14 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze methane;9-propan-2-yl-8H-purin-8-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;9-propan-2-yl-8H-purin-8-ide;yttrium?
The IUPAC name of methane;9-propan-2-yl-8H-purin-8-ide;yttrium (CID 157148419) is methane;9-propan-2-yl-8H-purin-8-ide;yttrium.
What is the SMILES notation for methane;9-propan-2-yl-8H-purin-8-ide;yttrium?
The canonical SMILES for methane;9-propan-2-yl-8H-purin-8-ide;yttrium is C.CC(C)n1[c-]nc2cncnc21.[Y].
What is the InChIKey of methane;9-propan-2-yl-8H-purin-8-ide;yttrium?
The InChIKey is CQNAQWXQMDJNCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N4.CH4.Y/c1-6(2)12-5-11-7-3-9-4-10-8(7)12;;/h3-4,6H,1-2H3;1H4;/q-1;;.
What are the key properties of methane;9-propan-2-yl-8H-purin-8-ide;yttrium?
methane;9-propan-2-yl-8H-purin-8-ide;yttrium has a molecular weight of 266.14 g/mol, XLogP of 1.84, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;9-propan-2-yl-8H-purin-8-ide;yttrium is sourced from PubChem (CID 157148419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).