About 3-propan-2-yl-7H-pyrrolo[2,3-c]pyridazine
3-propan-2-yl-7H-pyrrolo[2,3-c]pyridazine (PubChem CID 122697373) has the molecular formula C9H11N3
and a molecular weight of 161.21 g/mol. Its IUPAC name is 3-propan-2-yl-7H-pyrrolo[2,3-c]pyridazine.
Molecular Properties
| Compound Name | 3-propan-2-yl-7H-pyrrolo[2,3-c]pyridazine |
| PubChem CID | 122697373 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 3-propan-2-yl-7H-pyrrolo[2,3-c]pyridazine |
| SMILES | CC(C)c1cc2cc[nH]c2nn1 |
| InChI | InChI=1S/C9H11N3/c1-6(2)8-5-7-3-4-10-9(7)12-11-8/h3-6H,1-2H3,(H,10,12) |
| InChIKey | GSPBCLFFDOOBFU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-propan-2-yl-7H-pyrrolo[2,3-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yl-7H-pyrrolo[2,3-c]pyridazine?
The IUPAC name of 3-propan-2-yl-7H-pyrrolo[2,3-c]pyridazine (CID 122697373) is 3-propan-2-yl-7H-pyrrolo[2,3-c]pyridazine.
What is the SMILES notation for 3-propan-2-yl-7H-pyrrolo[2,3-c]pyridazine?
The canonical SMILES for 3-propan-2-yl-7H-pyrrolo[2,3-c]pyridazine is CC(C)c1cc2cc[nH]c2nn1.
What is the InChIKey of 3-propan-2-yl-7H-pyrrolo[2,3-c]pyridazine?
The InChIKey is GSPBCLFFDOOBFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3/c1-6(2)8-5-7-3-4-10-9(7)12-11-8/h3-6H,1-2H3,(H,10,12).
What are the key properties of 3-propan-2-yl-7H-pyrrolo[2,3-c]pyridazine?
3-propan-2-yl-7H-pyrrolo[2,3-c]pyridazine has a molecular weight of 161.21 g/mol, XLogP of 2.08, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yl-7H-pyrrolo[2,3-c]pyridazine is sourced from PubChem (CID 122697373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).