C34H40N4O7 — CID 122698150
3-[3-[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]propanoylamino]propyl N-[4-(1,3-dioxolan-2-yl)phenyl]carbamate (PubChem CID 122698150) has the molecular formula C34H40N4O7 and a molecular weight of 616.72 g/mol. Its IUPAC name is 3-[3-[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]propanoylamino]propyl N-[4-(1,3-dioxolan-2-yl)phenyl]carbamate.
| Compound Name | 3-[3-[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]propanoylamino]propyl N-[4-(1,3-dioxolan-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 122698150 |
| Molecular Formula | C34H40N4O7 |
| Molecular Weight | 616.72 g/mol |
| Exact Mass | 616.29 |
| IUPAC Name | 3-[3-[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]propanoylamino]propyl N-[4-(1,3-dioxolan-2-yl)phenyl]carbamate |
| SMILES | O=C(CCN1CCC(OC(=O)Nc2ccccc2-c2ccccc2)CC1)NCCCOC(=O)Nc1ccc(C2OCCO2)cc1 |
| InChI | InChI=1S/C34H40N4O7/c39-31(35-18-6-22-44-33(40)36-27-13-11-26(12-14-27)32-42-23-24-43-32)17-21-38-19-15-28(16-20-38)45-34(41)37-30-10-5-4-9-29(30)25-7-2-1-3-8-25/h1-5,7-14,28,32H,6,15-24H2,(H,35,39)(H,36,40)(H,37,41) |
| InChIKey | MVRTVJWXRVCMBC-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 127.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.72 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|