C18H26N6O2 — CID 122700011
tert-butyl N-[(7S)-3-(3,5-diamino-1,2,4-triazol-1-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl]carbamate (PubChem CID 122700011) has the molecular formula C18H26N6O2 and a molecular weight of 358.45 g/mol. Its IUPAC name is tert-butyl N-[(7S)-3-(3,5-diamino-1,2,4-triazol-1-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl]carbamate.
| Compound Name | tert-butyl N-[(7S)-3-(3,5-diamino-1,2,4-triazol-1-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl]carbamate |
|---|---|
| PubChem CID | 122700011 |
| Molecular Formula | C18H26N6O2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | tert-butyl N-[(7S)-3-(3,5-diamino-1,2,4-triazol-1-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCc2ccc(-n3nc(N)nc3N)cc2CC1 |
| InChI | InChI=1S/C18H26N6O2/c1-18(2,3)26-17(25)21-13-7-4-11-6-9-14(10-12(11)5-8-13)24-16(20)22-15(19)23-24/h6,9-10,13H,4-5,7-8H2,1-3H3,(H,21,25)(H4,19,20,22,23)/t13-/m0/s1 |
| InChIKey | KBGKBQLBAXZVCI-ZDUSSCGKSA-N |
| XLogP | 2.20 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |