C15H15NO5S — CID 122705238
5-[1-(benzenesulfonyl)pyrrol-3-yl]-5-oxopentanoic acid (PubChem CID 122705238) has the molecular formula C15H15NO5S and a molecular weight of 321.35 g/mol. Its IUPAC name is 5-[1-(benzenesulfonyl)pyrrol-3-yl]-5-oxopentanoic acid.
| Compound Name | 5-[1-(benzenesulfonyl)pyrrol-3-yl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 122705238 |
| Molecular Formula | C15H15NO5S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 5-[1-(benzenesulfonyl)pyrrol-3-yl]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)c1ccn(S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C15H15NO5S/c17-14(7-4-8-15(18)19)12-9-10-16(11-12)22(20,21)13-5-2-1-3-6-13/h1-3,5-6,9-11H,4,7-8H2,(H,18,19) |
| InChIKey | ABHXNXUNGWZJSG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |