C16H8Cl3FN2OS2 — CID 122712941
(5E)-5-[(4-fluorophenyl)methylidene]-2-sulfanylidene-3-(2,4,6-trichloroanilino)-1,3-thiazolidin-4-one (PubChem CID 122712941) has the molecular formula C16H8Cl3FN2OS2 and a molecular weight of 433.74 g/mol. Its IUPAC name is (5E)-5-[(4-fluorophenyl)methylidene]-2-sulfanylidene-3-(2,4,6-trichloroanilino)-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(4-fluorophenyl)methylidene]-2-sulfanylidene-3-(2,4,6-trichloroanilino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 122712941 |
| Molecular Formula | C16H8Cl3FN2OS2 |
| Molecular Weight | 433.74 g/mol |
| Exact Mass | 431.91 |
| IUPAC Name | (5E)-5-[(4-fluorophenyl)methylidene]-2-sulfanylidene-3-(2,4,6-trichloroanilino)-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2ccc(F)cc2)SC(=S)N1Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C16H8Cl3FN2OS2/c17-9-6-11(18)14(12(19)7-9)21-22-15(23)13(25-16(22)24)5-8-1-3-10(20)4-2-8/h1-7,21H/b13-5+ |
| InChIKey | MTUXRQHTBQCYOA-WLRTZDKTSA-N |
| XLogP | 6.01 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.74 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|