C16H8ClF4N3OS2 — CID 2321186
(5E)-3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-5-[(4-fluorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 2321186) has the molecular formula C16H8ClF4N3OS2 and a molecular weight of 433.84 g/mol. Its IUPAC name is (5E)-3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-5-[(4-fluorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-5-[(4-fluorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2321186 |
| Molecular Formula | C16H8ClF4N3OS2 |
| Molecular Weight | 433.84 g/mol |
| Exact Mass | 432.97 |
| IUPAC Name | (5E)-3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-5-[(4-fluorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2ccc(F)cc2)SC(=S)N1Nc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C16H8ClF4N3OS2/c17-11-6-9(16(19,20)21)7-22-13(11)23-24-14(25)12(27-15(24)26)5-8-1-3-10(18)4-2-8/h1-7H,(H,22,23)/b12-5+ |
| InChIKey | FZWVUPGNOPOYCF-LFYBBSHMSA-N |
| XLogP | 5.12 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.84 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|