C19H15ClF3N3O4S2 — CID 2320033
(5Z)-3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 2320033) has the molecular formula C19H15ClF3N3O4S2 and a molecular weight of 505.93 g/mol. Its IUPAC name is (5Z)-3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2320033 |
| Molecular Formula | C19H15ClF3N3O4S2 |
| Molecular Weight | 505.93 g/mol |
| Exact Mass | 505.01 |
| IUPAC Name | (5Z)-3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=C2\SC(=S)N(Nc3ncc(C(F)(F)F)cc3Cl)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C19H15ClF3N3O4S2/c1-28-12-4-9(5-13(29-2)15(12)30-3)6-14-17(27)26(18(31)32-14)25-16-11(20)7-10(8-24-16)19(21,22)23/h4-8H,1-3H3,(H,24,25)/b14-6- |
| InChIKey | VIMOVYKCVLCLBD-NSIKDUERSA-N |
| XLogP | 5.01 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.93 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|